About 2-(2,6-difluorophenyl)-N-(2-pyrrolidin-1-ylethyl)-1,3-benzoxazol-6-amine
2-(2,6-difluorophenyl)-N-(2-pyrrolidin-1-ylethyl)-1,3-benzoxazol-6-amine (PubChem CID 141071111) has the molecular formula C19H19F2N3O
and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-N-(2-pyrrolidin-1-ylethyl)-1,3-benzoxazol-6-amine.
Molecular Properties
| Compound Name | 2-(2,6-difluorophenyl)-N-(2-pyrrolidin-1-ylethyl)-1,3-benzoxazol-6-amine |
| PubChem CID | 141071111 |
| Molecular Formula | C19H19F2N3O |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-(2,6-difluorophenyl)-N-(2-pyrrolidin-1-ylethyl)-1,3-benzoxazol-6-amine |
| SMILES | Fc1cccc(F)c1-c1nc2ccc(NCCN3CCCC3)cc2o1 |
| InChI | InChI=1S/C19H19F2N3O/c20-14-4-3-5-15(21)18(14)19-23-16-7-6-13(12-17(16)25-19)22-8-11-24-9-1-2-10-24/h3-7,12,22H,1-2,8-11H2 |
| InChIKey | JMQFWBKLKPFIJC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,6-difluorophenyl)-N-(2-pyrrolidin-1-ylethyl)-1,3-benzoxazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-difluorophenyl)-N-(2-pyrrolidin-1-ylethyl)-1,3-benzoxazol-6-amine?
The IUPAC name of 2-(2,6-difluorophenyl)-N-(2-pyrrolidin-1-ylethyl)-1,3-benzoxazol-6-amine (CID 141071111) is 2-(2,6-difluorophenyl)-N-(2-pyrrolidin-1-ylethyl)-1,3-benzoxazol-6-amine.
What is the SMILES notation for 2-(2,6-difluorophenyl)-N-(2-pyrrolidin-1-ylethyl)-1,3-benzoxazol-6-amine?
The canonical SMILES for 2-(2,6-difluorophenyl)-N-(2-pyrrolidin-1-ylethyl)-1,3-benzoxazol-6-amine is Fc1cccc(F)c1-c1nc2ccc(NCCN3CCCC3)cc2o1.
What is the InChIKey of 2-(2,6-difluorophenyl)-N-(2-pyrrolidin-1-ylethyl)-1,3-benzoxazol-6-amine?
The InChIKey is JMQFWBKLKPFIJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19F2N3O/c20-14-4-3-5-15(21)18(14)19-23-16-7-6-13(12-17(16)25-19)22-8-11-24-9-1-2-10-24/h3-7,12,22H,1-2,8-11H2.
What are the key properties of 2-(2,6-difluorophenyl)-N-(2-pyrrolidin-1-ylethyl)-1,3-benzoxazol-6-amine?
2-(2,6-difluorophenyl)-N-(2-pyrrolidin-1-ylethyl)-1,3-benzoxazol-6-amine has a molecular weight of 343.38 g/mol, XLogP of 4.28, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-difluorophenyl)-N-(2-pyrrolidin-1-ylethyl)-1,3-benzoxazol-6-amine is sourced from PubChem (CID 141071111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).