C33H29FN6O6 — CID 157059328
4-(1,3-benzoxazol-2-yl)-2-nitro-N-(2-piperidin-1-ylethyl)aniline;2-(4-fluoro-3-nitrophenyl)-1,3-benzoxazole (PubChem CID 157059328) has the molecular formula C33H29FN6O6 and a molecular weight of 624.63 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-yl)-2-nitro-N-(2-piperidin-1-ylethyl)aniline;2-(4-fluoro-3-nitrophenyl)-1,3-benzoxazole.
| Compound Name | 4-(1,3-benzoxazol-2-yl)-2-nitro-N-(2-piperidin-1-ylethyl)aniline;2-(4-fluoro-3-nitrophenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 157059328 |
| Molecular Formula | C33H29FN6O6 |
| Molecular Weight | 624.63 g/mol |
| Exact Mass | 624.21 |
| IUPAC Name | 4-(1,3-benzoxazol-2-yl)-2-nitro-N-(2-piperidin-1-ylethyl)aniline;2-(4-fluoro-3-nitrophenyl)-1,3-benzoxazole |
| SMILES | O=[N+]([O-])c1cc(-c2nc3ccccc3o2)ccc1F.O=[N+]([O-])c1cc(-c2nc3ccccc3o2)ccc1NCCN1CCCCC1 |
| InChI | InChI=1S/C20H22N4O3.C13H7FN2O3/c25-24(26)18-14-15(20-22-17-6-2-3-7-19(17)27-20)8-9-16(18)21-10-13-23-11-4-1-5-12-23;14-9-6-5-8(7-11(9)16(17)18)13-15-10-3-1-2-4-12(10)19-13/h2-3,6-9,14,21H,1,4-5,10-13H2;1-7H |
| InChIKey | ABDFSVNSLFFPEU-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 153.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.63 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|