C19H18N2O4 — CID 159730970
2-[3-nitro-4-(oxan-4-ylmethyl)phenyl]-1,3-benzoxazole (PubChem CID 159730970) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-[3-nitro-4-(oxan-4-ylmethyl)phenyl]-1,3-benzoxazole.
| Compound Name | 2-[3-nitro-4-(oxan-4-ylmethyl)phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 159730970 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-[3-nitro-4-(oxan-4-ylmethyl)phenyl]-1,3-benzoxazole |
| SMILES | O=[N+]([O-])c1cc(-c2nc3ccccc3o2)ccc1CC1CCOCC1 |
| InChI | InChI=1S/C19H18N2O4/c22-21(23)17-12-15(19-20-16-3-1-2-4-18(16)25-19)6-5-14(17)11-13-7-9-24-10-8-13/h1-6,12-13H,7-11H2 |
| InChIKey | DQDLBKFEPILBIU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 78.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|