C19H19ClN2O2 — CID 158703549
5-(5-chloro-1,3-benzoxazol-2-yl)-2-(oxan-4-ylmethyl)aniline (PubChem CID 158703549) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 5-(5-chloro-1,3-benzoxazol-2-yl)-2-(oxan-4-ylmethyl)aniline.
| Compound Name | 5-(5-chloro-1,3-benzoxazol-2-yl)-2-(oxan-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 158703549 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 5-(5-chloro-1,3-benzoxazol-2-yl)-2-(oxan-4-ylmethyl)aniline |
| SMILES | Nc1cc(-c2nc3cc(Cl)ccc3o2)ccc1CC1CCOCC1 |
| InChI | InChI=1S/C19H19ClN2O2/c20-15-3-4-18-17(11-15)22-19(24-18)14-2-1-13(16(21)10-14)9-12-5-7-23-8-6-12/h1-4,10-12H,5-9,21H2 |
| InChIKey | IJFWITPQAZOQLY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|