C30H24FN5O7 — CID 158660268
2-[4-(1,3-benzoxazol-2-yl)-2-nitroanilino]butan-1-ol;2-(4-fluoro-3-nitrophenyl)-1,3-benzoxazole (PubChem CID 158660268) has the molecular formula C30H24FN5O7 and a molecular weight of 585.55 g/mol. Its IUPAC name is 2-[4-(1,3-benzoxazol-2-yl)-2-nitroanilino]butan-1-ol;2-(4-fluoro-3-nitrophenyl)-1,3-benzoxazole.
| Compound Name | 2-[4-(1,3-benzoxazol-2-yl)-2-nitroanilino]butan-1-ol;2-(4-fluoro-3-nitrophenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 158660268 |
| Molecular Formula | C30H24FN5O7 |
| Molecular Weight | 585.55 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | 2-[4-(1,3-benzoxazol-2-yl)-2-nitroanilino]butan-1-ol;2-(4-fluoro-3-nitrophenyl)-1,3-benzoxazole |
| SMILES | CCC(CO)Nc1ccc(-c2nc3ccccc3o2)cc1[N+](=O)[O-].O=[N+]([O-])c1cc(-c2nc3ccccc3o2)ccc1F |
| InChI | InChI=1S/C17H17N3O4.C13H7FN2O3/c1-2-12(10-21)18-13-8-7-11(9-15(13)20(22)23)17-19-14-5-3-4-6-16(14)24-17;14-9-6-5-8(7-11(9)16(17)18)13-15-10-3-1-2-4-12(10)19-13/h3-9,12,18,21H,2,10H2,1H3;1-7H |
| InChIKey | ICQYTGQAAGYCSP-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 170.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.55 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|