C23H21N2NaO5 — CID 161193343
sodium;ethanolate;2-(4-ethoxy-3-nitrophenyl)-5-phenyl-1,3-benzoxazole (PubChem CID 161193343) has the molecular formula C23H21N2NaO5 and a molecular weight of 428.42 g/mol. Its IUPAC name is sodium;ethanolate;2-(4-ethoxy-3-nitrophenyl)-5-phenyl-1,3-benzoxazole.
| Compound Name | sodium;ethanolate;2-(4-ethoxy-3-nitrophenyl)-5-phenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 161193343 |
| Molecular Formula | C23H21N2NaO5 |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | sodium;ethanolate;2-(4-ethoxy-3-nitrophenyl)-5-phenyl-1,3-benzoxazole |
| SMILES | CCOc1ccc(-c2nc3cc(-c4ccccc4)ccc3o2)cc1[N+](=O)[O-].CC[O-].[Na+] |
| InChI | InChI=1S/C21H16N2O4.C2H5O.Na/c1-2-26-20-11-9-16(13-18(20)23(24)25)21-22-17-12-15(8-10-19(17)27-21)14-6-4-3-5-7-14;1-2-3;/h3-13H,2H2,1H3;2H2,1H3;/q;-1;+1 |
| InChIKey | HEBGIYAEXDMXNJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 101.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|