C23H19NO3 — CID 50850714
ethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate (PubChem CID 50850714) has the molecular formula C23H19NO3 and a molecular weight of 357.41 g/mol. Its IUPAC name is ethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate.
| Compound Name | ethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate |
|---|---|
| PubChem CID | 50850714 |
| Molecular Formula | C23H19NO3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | ethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1cccc(-c2nc3cc(-c4ccccc4)ccc3o2)c1 |
| InChI | InChI=1S/C23H19NO3/c1-2-26-22(25)14-16-7-6-10-19(13-16)23-24-20-15-18(11-12-21(20)27-23)17-8-4-3-5-9-17/h3-13,15H,2,14H2,1H3 |
| InChIKey | RYZDZVONIKGCLR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |