ethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate

C23H19NO3 — CID 50850714

IUPACethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate
SMILESCCOC(=O)Cc1cccc(-c2nc3cc(-c4ccccc4)ccc3o2)c1
InChIInChI=1S/C23H19NO3/c1-2-26-22(25)14-16-7-6-10-19(13-16)23-24-20-15-18(11-12-21(20)27-23)17-8-4-3-5-9-17/h3-13,15H,2,14H2,1H3
InChIKeyRYZDZVONIKGCLR-UHFFFAOYSA-N
MW357.41 g/mol
LogP5.27
Rot. Bonds5

About ethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate

ethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate (PubChem CID 50850714) has the molecular formula C23H19NO3 and a molecular weight of 357.41 g/mol. Its IUPAC name is ethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate.

Molecular Properties

Compound Nameethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate
PubChem CID50850714
Molecular FormulaC23H19NO3
Molecular Weight357.41 g/mol
Exact Mass357.14
IUPAC Nameethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate
SMILESCCOC(=O)Cc1cccc(-c2nc3cc(-c4ccccc4)ccc3o2)c1
InChIInChI=1S/C23H19NO3/c1-2-26-22(25)14-16-7-6-10-19(13-16)23-24-20-15-18(11-12-21(20)27-23)17-8-4-3-5-9-17/h3-13,15H,2,14H2,1H3
InChIKeyRYZDZVONIKGCLR-UHFFFAOYSA-N
XLogP5.27
TPSA52.33 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms27
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500357.41
LogP ≤ 55.27
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate?
The IUPAC name of ethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate (CID 50850714) is ethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate.
What is the SMILES notation for ethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate?
The canonical SMILES for ethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate is CCOC(=O)Cc1cccc(-c2nc3cc(-c4ccccc4)ccc3o2)c1.
What is the InChIKey of ethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate?
The InChIKey is RYZDZVONIKGCLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19NO3/c1-2-26-22(25)14-16-7-6-10-19(13-16)23-24-20-15-18(11-12-21(20)27-23)17-8-4-3-5-9-17/h3-13,15H,2,14H2,1H3.
What are the key properties of ethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate?
ethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate has a molecular weight of 357.41 g/mol, XLogP of 5.27, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3-(5-phenyl-1,3-benzoxazol-2-yl)phenyl]acetate is sourced from PubChem (CID 50850714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).