C17H15F2N3O3 — CID 91574308
2-(2,5-difluorophenyl)-6-[2-(dimethylamino)ethylimino]-1,3-benzoxazole-4,7-dione (PubChem CID 91574308) has the molecular formula C17H15F2N3O3 and a molecular weight of 347.32 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-6-[2-(dimethylamino)ethylimino]-1,3-benzoxazole-4,7-dione.
| Compound Name | 2-(2,5-difluorophenyl)-6-[2-(dimethylamino)ethylimino]-1,3-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 91574308 |
| Molecular Formula | C17H15F2N3O3 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-(2,5-difluorophenyl)-6-[2-(dimethylamino)ethylimino]-1,3-benzoxazole-4,7-dione |
| SMILES | CN(C)CC/N=C1\CC(=O)c2nc(-c3cc(F)ccc3F)oc2C1=O |
| InChI | InChI=1S/C17H15F2N3O3/c1-22(2)6-5-20-12-8-13(23)14-16(15(12)24)25-17(21-14)10-7-9(18)3-4-11(10)19/h3-4,7H,5-6,8H2,1-2H3/b20-12+ |
| InChIKey | DSMJOGWDVVXKDH-UDWIEESQSA-N |
| XLogP | 2.39 |
| TPSA | 75.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|