C16H20N4O3S — CID 91151640
6-[2-(dimethylamino)ethylimino]-2-(pyrrolidine-1-carbonyl)-1,3-benzothiazole-4,7-dione (PubChem CID 91151640) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is 6-[2-(dimethylamino)ethylimino]-2-(pyrrolidine-1-carbonyl)-1,3-benzothiazole-4,7-dione.
| Compound Name | 6-[2-(dimethylamino)ethylimino]-2-(pyrrolidine-1-carbonyl)-1,3-benzothiazole-4,7-dione |
|---|---|
| PubChem CID | 91151640 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 6-[2-(dimethylamino)ethylimino]-2-(pyrrolidine-1-carbonyl)-1,3-benzothiazole-4,7-dione |
| SMILES | CN(C)CC/N=C1\CC(=O)c2nc(C(=O)N3CCCC3)sc2C1=O |
| InChI | InChI=1S/C16H20N4O3S/c1-19(2)8-5-17-10-9-11(21)12-14(13(10)22)24-15(18-12)16(23)20-6-3-4-7-20/h3-9H2,1-2H3/b17-10+ |
| InChIKey | XRZFHUKLFXUOSP-LICLKQGHSA-N |
| XLogP | 1.15 |
| TPSA | 82.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|