About (7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-piperidin-1-ylmethanone
(7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-piperidin-1-ylmethanone (PubChem CID 90390609) has the molecular formula C12H14N4OS2
and a molecular weight of 294.40 g/mol. Its IUPAC name is (7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | (7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-piperidin-1-ylmethanone |
| PubChem CID | 90390609 |
| Molecular Formula | C12H14N4OS2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | (7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-piperidin-1-ylmethanone |
| SMILES | CSc1ncnc2sc(C(=O)N3CCCCC3)nc12 |
| InChI | InChI=1S/C12H14N4OS2/c1-18-9-8-10(14-7-13-9)19-11(15-8)12(17)16-5-3-2-4-6-16/h7H,2-6H2,1H3 |
| InChIKey | SYZXBSRZYGGQGC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-piperidin-1-ylmethanone?
The IUPAC name of (7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-piperidin-1-ylmethanone (CID 90390609) is (7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-piperidin-1-ylmethanone.
What is the SMILES notation for (7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-piperidin-1-ylmethanone?
The canonical SMILES for (7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-piperidin-1-ylmethanone is CSc1ncnc2sc(C(=O)N3CCCCC3)nc12.
What is the InChIKey of (7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-piperidin-1-ylmethanone?
The InChIKey is SYZXBSRZYGGQGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4OS2/c1-18-9-8-10(14-7-13-9)19-11(15-8)12(17)16-5-3-2-4-6-16/h7H,2-6H2,1H3.
What are the key properties of (7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-piperidin-1-ylmethanone?
(7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-piperidin-1-ylmethanone has a molecular weight of 294.40 g/mol, XLogP of 2.43, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-piperidin-1-ylmethanone is sourced from PubChem (CID 90390609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).