C18H18FN3O4 — CID 91216548
6-[2-(dimethylamino)ethylimino]-2-(2-fluoro-6-methoxyphenyl)-1,3-benzoxazole-4,7-dione (PubChem CID 91216548) has the molecular formula C18H18FN3O4 and a molecular weight of 359.36 g/mol. Its IUPAC name is 6-[2-(dimethylamino)ethylimino]-2-(2-fluoro-6-methoxyphenyl)-1,3-benzoxazole-4,7-dione.
| Compound Name | 6-[2-(dimethylamino)ethylimino]-2-(2-fluoro-6-methoxyphenyl)-1,3-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 91216548 |
| Molecular Formula | C18H18FN3O4 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 6-[2-(dimethylamino)ethylimino]-2-(2-fluoro-6-methoxyphenyl)-1,3-benzoxazole-4,7-dione |
| SMILES | COc1cccc(F)c1-c1nc2c(o1)C(=O)/C(=N/CCN(C)C)CC2=O |
| InChI | InChI=1S/C18H18FN3O4/c1-22(2)8-7-20-11-9-12(23)15-17(16(11)24)26-18(21-15)14-10(19)5-4-6-13(14)25-3/h4-6H,7-9H2,1-3H3/b20-11+ |
| InChIKey | SAQGKWZJHOYNBP-RGVLZGJSSA-N |
| XLogP | 2.26 |
| TPSA | 85.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|