C19H15F4N3O2S — CID 174476621
2-[5-[2-(dimethylamino)ethylamino]-2-(2,3,4,5-tetrafluorophenyl)-1,3-benzothiazol-7-yl]-2-oxoacetaldehyde (PubChem CID 174476621) has the molecular formula C19H15F4N3O2S and a molecular weight of 425.41 g/mol. Its IUPAC name is 2-[5-[2-(dimethylamino)ethylamino]-2-(2,3,4,5-tetrafluorophenyl)-1,3-benzothiazol-7-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[5-[2-(dimethylamino)ethylamino]-2-(2,3,4,5-tetrafluorophenyl)-1,3-benzothiazol-7-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 174476621 |
| Molecular Formula | C19H15F4N3O2S |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 2-[5-[2-(dimethylamino)ethylamino]-2-(2,3,4,5-tetrafluorophenyl)-1,3-benzothiazol-7-yl]-2-oxoacetaldehyde |
| SMILES | CN(C)CCNc1cc(C(=O)C=O)c2sc(-c3cc(F)c(F)c(F)c3F)nc2c1 |
| InChI | InChI=1S/C19H15F4N3O2S/c1-26(2)4-3-24-9-5-10(14(28)8-27)18-13(6-9)25-19(29-18)11-7-12(20)16(22)17(23)15(11)21/h5-8,24H,3-4H2,1-2H3 |
| InChIKey | BYQLINYPXNSEKU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|