C17H16F4N2O — CID 75418468
N-[2-(dimethylamino)ethyl]-2,3,4,5-tetrafluoro-N-phenylbenzamide (PubChem CID 75418468) has the molecular formula C17H16F4N2O and a molecular weight of 340.32 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2,3,4,5-tetrafluoro-N-phenylbenzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2,3,4,5-tetrafluoro-N-phenylbenzamide |
|---|---|
| PubChem CID | 75418468 |
| Molecular Formula | C17H16F4N2O |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2,3,4,5-tetrafluoro-N-phenylbenzamide |
| SMILES | CN(C)CCN(C(=O)c1cc(F)c(F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C17H16F4N2O/c1-22(2)8-9-23(11-6-4-3-5-7-11)17(24)12-10-13(18)15(20)16(21)14(12)19/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | QTXMMJWNBVCOIE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|