C13H17F4N3O — CID 122560896
1-[2-(dimethylamino)ethyl]-1-methyl-3-[(2,3,4,5-tetrafluorophenyl)methyl]urea (PubChem CID 122560896) has the molecular formula C13H17F4N3O and a molecular weight of 307.29 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-1-methyl-3-[(2,3,4,5-tetrafluorophenyl)methyl]urea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-1-methyl-3-[(2,3,4,5-tetrafluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 122560896 |
| Molecular Formula | C13H17F4N3O |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-1-methyl-3-[(2,3,4,5-tetrafluorophenyl)methyl]urea |
| SMILES | CN(C)CCN(C)C(=O)NCc1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H17F4N3O/c1-19(2)4-5-20(3)13(21)18-7-8-6-9(14)11(16)12(17)10(8)15/h6H,4-5,7H2,1-3H3,(H,18,21) |
| InChIKey | BJLRJZXFGXYDSY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|