C17H15F5N2O — CID 97187528
(2S)-2-(dimethylamino)-2-(3-fluorophenyl)-N-[(2,3,4,5-tetrafluorophenyl)methyl]acetamide (PubChem CID 97187528) has the molecular formula C17H15F5N2O and a molecular weight of 358.31 g/mol. Its IUPAC name is (2S)-2-(dimethylamino)-2-(3-fluorophenyl)-N-[(2,3,4,5-tetrafluorophenyl)methyl]acetamide.
| Compound Name | (2S)-2-(dimethylamino)-2-(3-fluorophenyl)-N-[(2,3,4,5-tetrafluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 97187528 |
| Molecular Formula | C17H15F5N2O |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (2S)-2-(dimethylamino)-2-(3-fluorophenyl)-N-[(2,3,4,5-tetrafluorophenyl)methyl]acetamide |
| SMILES | CN(C)[C@H](C(=O)NCc1cc(F)c(F)c(F)c1F)c1cccc(F)c1 |
| InChI | InChI=1S/C17H15F5N2O/c1-24(2)16(9-4-3-5-11(18)6-9)17(25)23-8-10-7-12(19)14(21)15(22)13(10)20/h3-7,16H,8H2,1-2H3,(H,23,25)/t16-/m0/s1 |
| InChIKey | SQIJHZFFJUWVOU-INIZCTEOSA-N |
| XLogP | 3.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|