C17H17ClF2N2O — CID 97200430
(2R)-N-[(2-chloro-6-fluorophenyl)methyl]-2-(dimethylamino)-2-(3-fluorophenyl)acetamide (PubChem CID 97200430) has the molecular formula C17H17ClF2N2O and a molecular weight of 338.79 g/mol. Its IUPAC name is (2R)-N-[(2-chloro-6-fluorophenyl)methyl]-2-(dimethylamino)-2-(3-fluorophenyl)acetamide.
| Compound Name | (2R)-N-[(2-chloro-6-fluorophenyl)methyl]-2-(dimethylamino)-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 97200430 |
| Molecular Formula | C17H17ClF2N2O |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (2R)-N-[(2-chloro-6-fluorophenyl)methyl]-2-(dimethylamino)-2-(3-fluorophenyl)acetamide |
| SMILES | CN(C)[C@@H](C(=O)NCc1c(F)cccc1Cl)c1cccc(F)c1 |
| InChI | InChI=1S/C17H17ClF2N2O/c1-22(2)16(11-5-3-6-12(19)9-11)17(23)21-10-13-14(18)7-4-8-15(13)20/h3-9,16H,10H2,1-2H3,(H,21,23)/t16-/m1/s1 |
| InChIKey | LFBIHDZQYZCTGO-MRXNPFEDSA-N |
| XLogP | 3.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |