C17H16F3N3O — CID 91115302
N',N'-dimethyl-N-[2-(3,4,5-trifluorophenyl)-1,3-benzoxazol-6-yl]ethane-1,2-diamine (PubChem CID 91115302) has the molecular formula C17H16F3N3O and a molecular weight of 335.33 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-(3,4,5-trifluorophenyl)-1,3-benzoxazol-6-yl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[2-(3,4,5-trifluorophenyl)-1,3-benzoxazol-6-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 91115302 |
| Molecular Formula | C17H16F3N3O |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N',N'-dimethyl-N-[2-(3,4,5-trifluorophenyl)-1,3-benzoxazol-6-yl]ethane-1,2-diamine |
| SMILES | CN(C)CCNc1ccc2nc(-c3cc(F)c(F)c(F)c3)oc2c1 |
| InChI | InChI=1S/C17H16F3N3O/c1-23(2)6-5-21-11-3-4-14-15(9-11)24-17(22-14)10-7-12(18)16(20)13(19)8-10/h3-4,7-9,21H,5-6H2,1-2H3 |
| InChIKey | JEQQPTUUVIVMJR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|