C20H17F4N3O3 — CID 174463393
2-[5-[2-(dimethylamino)ethylamino]-2-[2-fluoro-6-(trifluoromethyl)phenyl]-1,3-benzoxazol-7-yl]-2-oxoacetaldehyde (PubChem CID 174463393) has the molecular formula C20H17F4N3O3 and a molecular weight of 423.37 g/mol. Its IUPAC name is 2-[5-[2-(dimethylamino)ethylamino]-2-[2-fluoro-6-(trifluoromethyl)phenyl]-1,3-benzoxazol-7-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[5-[2-(dimethylamino)ethylamino]-2-[2-fluoro-6-(trifluoromethyl)phenyl]-1,3-benzoxazol-7-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 174463393 |
| Molecular Formula | C20H17F4N3O3 |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-[5-[2-(dimethylamino)ethylamino]-2-[2-fluoro-6-(trifluoromethyl)phenyl]-1,3-benzoxazol-7-yl]-2-oxoacetaldehyde |
| SMILES | CN(C)CCNc1cc(C(=O)C=O)c2oc(-c3c(F)cccc3C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C20H17F4N3O3/c1-27(2)7-6-25-11-8-12(16(29)10-28)18-15(9-11)26-19(30-18)17-13(20(22,23)24)4-3-5-14(17)21/h3-5,8-10,25H,6-7H2,1-2H3 |
| InChIKey | LKSUUZZTGFGIBP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|