C21H20F6N2O — CID 87559291
1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-[2-(dimethylamino)ethylamino]phenyl]prop-2-en-1-one (PubChem CID 87559291) has the molecular formula C21H20F6N2O and a molecular weight of 430.39 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-[2-(dimethylamino)ethylamino]phenyl]prop-2-en-1-one.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-[2-(dimethylamino)ethylamino]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 87559291 |
| Molecular Formula | C21H20F6N2O |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-[2-(dimethylamino)ethylamino]phenyl]prop-2-en-1-one |
| SMILES | CN(C)CCNc1ccc(C=CC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H20F6N2O/c1-29(2)10-9-28-18-6-3-14(4-7-18)5-8-19(30)15-11-16(20(22,23)24)13-17(12-15)21(25,26)27/h3-8,11-13,28H,9-10H2,1-2H3 |
| InChIKey | USJZSOLRJFTGRM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|