C20H23ClN2O — CID 50915181
(E)-3-(4-chlorophenyl)-1-[4-[3-(dimethylamino)propylamino]phenyl]prop-2-en-1-one (PubChem CID 50915181) has the molecular formula C20H23ClN2O and a molecular weight of 342.87 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-[4-[3-(dimethylamino)propylamino]phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-[4-[3-(dimethylamino)propylamino]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 50915181 |
| Molecular Formula | C20H23ClN2O |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-[4-[3-(dimethylamino)propylamino]phenyl]prop-2-en-1-one |
| SMILES | CN(C)CCCNc1ccc(C(=O)/C=C/c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H23ClN2O/c1-23(2)15-3-14-22-19-11-7-17(8-12-19)20(24)13-6-16-4-9-18(21)10-5-16/h4-13,22H,3,14-15H2,1-2H3/b13-6+ |
| InChIKey | HRLVAEWMGCCTCG-AWNIVKPZSA-N |
| XLogP | 4.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|