C20H21Cl2NO — CID 19883685
(E)-3-(3,5-dichlorophenyl)-1-[4-[3-(dimethylamino)propyl]phenyl]prop-2-en-1-one (PubChem CID 19883685) has the molecular formula C20H21Cl2NO and a molecular weight of 362.30 g/mol. Its IUPAC name is (E)-3-(3,5-dichlorophenyl)-1-[4-[3-(dimethylamino)propyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-dichlorophenyl)-1-[4-[3-(dimethylamino)propyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19883685 |
| Molecular Formula | C20H21Cl2NO |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | (E)-3-(3,5-dichlorophenyl)-1-[4-[3-(dimethylamino)propyl]phenyl]prop-2-en-1-one |
| SMILES | CN(C)CCCc1ccc(C(=O)/C=C/c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C20H21Cl2NO/c1-23(2)11-3-4-15-5-8-17(9-6-15)20(24)10-7-16-12-18(21)14-19(22)13-16/h5-10,12-14H,3-4,11H2,1-2H3/b10-7+ |
| InChIKey | HMEKMVWNEWXPIQ-JXMROGBWSA-N |
| XLogP | 5.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|