C23H26N2O5 — CID 11223603
(E)-but-2-enedioic acid;(E)-1-[4-[2-(dimethylamino)ethylamino]phenyl]-3-phenylprop-2-en-1-one (PubChem CID 11223603) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(E)-1-[4-[2-(dimethylamino)ethylamino]phenyl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-but-2-enedioic acid;(E)-1-[4-[2-(dimethylamino)ethylamino]phenyl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 11223603 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (E)-but-2-enedioic acid;(E)-1-[4-[2-(dimethylamino)ethylamino]phenyl]-3-phenylprop-2-en-1-one |
| SMILES | CN(C)CCNc1ccc(C(=O)/C=C/c2ccccc2)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H22N2O.C4H4O4/c1-21(2)15-14-20-18-11-9-17(10-12-18)19(22)13-8-16-6-4-3-5-7-16;5-3(6)1-2-4(7)8/h3-13,20H,14-15H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b13-8+;2-1+ |
| InChIKey | WNFILKBFZZYBPJ-WDOSNMPVSA-N |
| XLogP | 3.27 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|