C25H34N4O — CID 68744571
3-[4-[2-(dimethylamino)ethylamino]phenyl]-1-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]prop-2-en-1-one (PubChem CID 68744571) has the molecular formula C25H34N4O and a molecular weight of 406.57 g/mol. Its IUPAC name is 3-[4-[2-(dimethylamino)ethylamino]phenyl]-1-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]prop-2-en-1-one.
| Compound Name | 3-[4-[2-(dimethylamino)ethylamino]phenyl]-1-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 68744571 |
| Molecular Formula | C25H34N4O |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 3-[4-[2-(dimethylamino)ethylamino]phenyl]-1-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]prop-2-en-1-one |
| SMILES | CN(C)CCNc1ccc(C=CC(=O)c2ccccc2CN2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C25H34N4O/c1-27(2)15-14-26-23-11-8-21(9-12-23)10-13-25(30)24-7-5-4-6-22(24)20-29-18-16-28(3)17-19-29/h4-13,26H,14-20H2,1-3H3 |
| InChIKey | JIFMYDDCTGSEAT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|