C26H34N4O3 — CID 10478937
(E)-1-[4-[2-(dimethylamino)ethylamino]phenyl]-3-[3-[4-(2-methoxyacetyl)piperazin-1-yl]phenyl]prop-2-en-1-one (PubChem CID 10478937) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is (E)-1-[4-[2-(dimethylamino)ethylamino]phenyl]-3-[3-[4-(2-methoxyacetyl)piperazin-1-yl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-[2-(dimethylamino)ethylamino]phenyl]-3-[3-[4-(2-methoxyacetyl)piperazin-1-yl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 10478937 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | (E)-1-[4-[2-(dimethylamino)ethylamino]phenyl]-3-[3-[4-(2-methoxyacetyl)piperazin-1-yl]phenyl]prop-2-en-1-one |
| SMILES | COCC(=O)N1CCN(c2cccc(/C=C/C(=O)c3ccc(NCCN(C)C)cc3)c2)CC1 |
| InChI | InChI=1S/C26H34N4O3/c1-28(2)14-13-27-23-10-8-22(9-11-23)25(31)12-7-21-5-4-6-24(19-21)29-15-17-30(18-16-29)26(32)20-33-3/h4-12,19,27H,13-18,20H2,1-3H3/b12-7+ |
| InChIKey | JBVCVOFHTRLWJN-KPKJPENVSA-N |
| XLogP | 2.85 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|