C19H22N4O3 — CID 92571097
4,5-bis(furan-2-yl)-N-(3-morpholin-4-ylpropyl)pyrimidin-2-amine (PubChem CID 92571097) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 4,5-bis(furan-2-yl)-N-(3-morpholin-4-ylpropyl)pyrimidin-2-amine.
| Compound Name | 4,5-bis(furan-2-yl)-N-(3-morpholin-4-ylpropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 92571097 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 4,5-bis(furan-2-yl)-N-(3-morpholin-4-ylpropyl)pyrimidin-2-amine |
| SMILES | c1coc(-c2cnc(NCCCN3CCOCC3)nc2-c2ccco2)c1 |
| InChI | InChI=1S/C19H22N4O3/c1-4-16(25-10-1)15-14-21-19(22-18(15)17-5-2-11-26-17)20-6-3-7-23-8-12-24-13-9-23/h1-2,4-5,10-11,14H,3,6-9,12-13H2,(H,20,21,22) |
| InChIKey | JWBDODMPGQJMPK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|