C25H17BrN2O3 — CID 158867521
1-[2,3-bis(furan-2-yl)quinoxalin-6-yl]-3-(2-bromophenyl)propan-2-one (PubChem CID 158867521) has the molecular formula C25H17BrN2O3 and a molecular weight of 473.33 g/mol. Its IUPAC name is 1-[2,3-bis(furan-2-yl)quinoxalin-6-yl]-3-(2-bromophenyl)propan-2-one.
| Compound Name | 1-[2,3-bis(furan-2-yl)quinoxalin-6-yl]-3-(2-bromophenyl)propan-2-one |
|---|---|
| PubChem CID | 158867521 |
| Molecular Formula | C25H17BrN2O3 |
| Molecular Weight | 473.33 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | 1-[2,3-bis(furan-2-yl)quinoxalin-6-yl]-3-(2-bromophenyl)propan-2-one |
| SMILES | O=C(Cc1ccc2nc(-c3ccco3)c(-c3ccco3)nc2c1)Cc1ccccc1Br |
| InChI | InChI=1S/C25H17BrN2O3/c26-19-6-2-1-5-17(19)15-18(29)13-16-9-10-20-21(14-16)28-25(23-8-4-12-31-23)24(27-20)22-7-3-11-30-22/h1-12,14H,13,15H2 |
| InChIKey | QTBLVISHOCVIBH-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.33 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |