C19H18N2O — CID 158965713
1-(2,3-dimethylquinoxalin-6-yl)-3-phenylpropan-2-one (PubChem CID 158965713) has the molecular formula C19H18N2O and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-(2,3-dimethylquinoxalin-6-yl)-3-phenylpropan-2-one.
| Compound Name | 1-(2,3-dimethylquinoxalin-6-yl)-3-phenylpropan-2-one |
|---|---|
| PubChem CID | 158965713 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 1-(2,3-dimethylquinoxalin-6-yl)-3-phenylpropan-2-one |
| SMILES | Cc1nc2ccc(CC(=O)Cc3ccccc3)cc2nc1C |
| InChI | InChI=1S/C19H18N2O/c1-13-14(2)21-19-12-16(8-9-18(19)20-13)11-17(22)10-15-6-4-3-5-7-15/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | GPXMCZYACFSTAQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |