C30H22N2O3 — CID 158867523
1-[2,3-bis(furan-2-yl)benzo[f]quinoxalin-6-yl]-3-(4-methylphenyl)propan-2-one (PubChem CID 158867523) has the molecular formula C30H22N2O3 and a molecular weight of 458.52 g/mol. Its IUPAC name is 1-[2,3-bis(furan-2-yl)benzo[f]quinoxalin-6-yl]-3-(4-methylphenyl)propan-2-one.
| Compound Name | 1-[2,3-bis(furan-2-yl)benzo[f]quinoxalin-6-yl]-3-(4-methylphenyl)propan-2-one |
|---|---|
| PubChem CID | 158867523 |
| Molecular Formula | C30H22N2O3 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 1-[2,3-bis(furan-2-yl)benzo[f]quinoxalin-6-yl]-3-(4-methylphenyl)propan-2-one |
| SMILES | Cc1ccc(CC(=O)Cc2cc3nc(-c4ccco4)c(-c4ccco4)nc3c3ccccc23)cc1 |
| InChI | InChI=1S/C30H22N2O3/c1-19-10-12-20(13-11-19)16-22(33)17-21-18-25-28(24-7-3-2-6-23(21)24)32-30(27-9-5-15-35-27)29(31-25)26-8-4-14-34-26/h2-15,18H,16-17H2,1H3 |
| InChIKey | IAFDOLJKUACRGI-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|