C32H34N2 — CID 149011532
2-[5-(2,7-ditert-butylanthracen-9-yl)-1H-pyrrol-2-yl]-6-methylpyridine (PubChem CID 149011532) has the molecular formula C32H34N2 and a molecular weight of 446.64 g/mol. Its IUPAC name is 2-[5-(2,7-ditert-butylanthracen-9-yl)-1H-pyrrol-2-yl]-6-methylpyridine.
| Compound Name | 2-[5-(2,7-ditert-butylanthracen-9-yl)-1H-pyrrol-2-yl]-6-methylpyridine |
|---|---|
| PubChem CID | 149011532 |
| Molecular Formula | C32H34N2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 2-[5-(2,7-ditert-butylanthracen-9-yl)-1H-pyrrol-2-yl]-6-methylpyridine |
| SMILES | Cc1cccc(-c2ccc(-c3c4cc(C(C)(C)C)ccc4cc4ccc(C(C)(C)C)cc34)[nH]2)n1 |
| InChI | InChI=1S/C32H34N2/c1-20-9-8-10-27(33-20)28-15-16-29(34-28)30-25-18-23(31(2,3)4)13-11-21(25)17-22-12-14-24(19-26(22)30)32(5,6)7/h8-19,34H,1-7H3 |
| InChIKey | QBPYYNUQRDAPDB-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|