C29H34N2 — CID 162693126
4-(3-tert-butyl-5-methylphenyl)-2,10-di(propan-2-yl)benzo[h]quinazoline (PubChem CID 162693126) has the molecular formula C29H34N2 and a molecular weight of 410.61 g/mol. Its IUPAC name is 4-(3-tert-butyl-5-methylphenyl)-2,10-di(propan-2-yl)benzo[h]quinazoline.
| Compound Name | 4-(3-tert-butyl-5-methylphenyl)-2,10-di(propan-2-yl)benzo[h]quinazoline |
|---|---|
| PubChem CID | 162693126 |
| Molecular Formula | C29H34N2 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 4-(3-tert-butyl-5-methylphenyl)-2,10-di(propan-2-yl)benzo[h]quinazoline |
| SMILES | Cc1cc(-c2nc(C(C)C)nc3c2ccc2cccc(C(C)C)c23)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H34N2/c1-17(2)23-11-9-10-20-12-13-24-26(30-28(18(3)4)31-27(24)25(20)23)21-14-19(5)15-22(16-21)29(6,7)8/h9-18H,1-8H3 |
| InChIKey | NKZKCHDMYKYVFB-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|