C25H26N2 — CID 162692996
4-(2,4-dimethylphenyl)-8,10-dimethyl-2-propan-2-ylbenzo[h]quinazoline (PubChem CID 162692996) has the molecular formula C25H26N2 and a molecular weight of 354.50 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-8,10-dimethyl-2-propan-2-ylbenzo[h]quinazoline.
| Compound Name | 4-(2,4-dimethylphenyl)-8,10-dimethyl-2-propan-2-ylbenzo[h]quinazoline |
|---|---|
| PubChem CID | 162692996 |
| Molecular Formula | C25H26N2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-8,10-dimethyl-2-propan-2-ylbenzo[h]quinazoline |
| SMILES | Cc1ccc(-c2nc(C(C)C)nc3c2ccc2cc(C)cc(C)c23)c(C)c1 |
| InChI | InChI=1S/C25H26N2/c1-14(2)25-26-23(20-9-7-15(3)11-17(20)5)21-10-8-19-13-16(4)12-18(6)22(19)24(21)27-25/h7-14H,1-6H3 |
| InChIKey | DHUHOAURDNAFGA-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|