C30H36N2 — CID 162692416
4-(3-tert-butyl-5-methylphenyl)-10-(2-methylpropyl)-2-propan-2-ylbenzo[h]quinazoline (PubChem CID 162692416) has the molecular formula C30H36N2 and a molecular weight of 424.63 g/mol. Its IUPAC name is 4-(3-tert-butyl-5-methylphenyl)-10-(2-methylpropyl)-2-propan-2-ylbenzo[h]quinazoline.
| Compound Name | 4-(3-tert-butyl-5-methylphenyl)-10-(2-methylpropyl)-2-propan-2-ylbenzo[h]quinazoline |
|---|---|
| PubChem CID | 162692416 |
| Molecular Formula | C30H36N2 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.29 |
| IUPAC Name | 4-(3-tert-butyl-5-methylphenyl)-10-(2-methylpropyl)-2-propan-2-ylbenzo[h]quinazoline |
| SMILES | Cc1cc(-c2nc(C(C)C)nc3c2ccc2cccc(CC(C)C)c23)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H36N2/c1-18(2)14-22-11-9-10-21-12-13-25-27(31-29(19(3)4)32-28(25)26(21)22)23-15-20(5)16-24(17-23)30(6,7)8/h9-13,15-19H,14H2,1-8H3 |
| InChIKey | NNWBCNXDYSXHLK-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|