C36H38N2O — CID 162692866
4-(7-methyldibenzofuran-4-yl)-8,10-bis(2-methylpropyl)-2-propan-2-ylbenzo[h]quinazoline (PubChem CID 162692866) has the molecular formula C36H38N2O and a molecular weight of 514.71 g/mol. Its IUPAC name is 4-(7-methyldibenzofuran-4-yl)-8,10-bis(2-methylpropyl)-2-propan-2-ylbenzo[h]quinazoline.
| Compound Name | 4-(7-methyldibenzofuran-4-yl)-8,10-bis(2-methylpropyl)-2-propan-2-ylbenzo[h]quinazoline |
|---|---|
| PubChem CID | 162692866 |
| Molecular Formula | C36H38N2O |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.30 |
| IUPAC Name | 4-(7-methyldibenzofuran-4-yl)-8,10-bis(2-methylpropyl)-2-propan-2-ylbenzo[h]quinazoline |
| SMILES | Cc1ccc2c(c1)oc1c(-c3nc(C(C)C)nc4c3ccc3cc(CC(C)C)cc(CC(C)C)c34)cccc12 |
| InChI | InChI=1S/C36H38N2O/c1-20(2)15-24-18-25-12-14-29-33(30-10-8-9-28-27-13-11-23(7)17-31(27)39-35(28)30)37-36(22(5)6)38-34(29)32(25)26(19-24)16-21(3)4/h8-14,17-22H,15-16H2,1-7H3 |
| InChIKey | RNCZSGLGFDGDHJ-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|