C32H30N2O — CID 162692667
8-tert-butyl-4-(2,7-dimethyldibenzofuran-4-yl)-2,10-dimethylbenzo[h]quinazoline (PubChem CID 162692667) has the molecular formula C32H30N2O and a molecular weight of 458.61 g/mol. Its IUPAC name is 8-tert-butyl-4-(2,7-dimethyldibenzofuran-4-yl)-2,10-dimethylbenzo[h]quinazoline.
| Compound Name | 8-tert-butyl-4-(2,7-dimethyldibenzofuran-4-yl)-2,10-dimethylbenzo[h]quinazoline |
|---|---|
| PubChem CID | 162692667 |
| Molecular Formula | C32H30N2O |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 8-tert-butyl-4-(2,7-dimethyldibenzofuran-4-yl)-2,10-dimethylbenzo[h]quinazoline |
| SMILES | Cc1ccc2c(c1)oc1c(-c3nc(C)nc4c3ccc3cc(C(C)(C)C)cc(C)c34)cc(C)cc12 |
| InChI | InChI=1S/C32H30N2O/c1-17-8-10-23-25-12-18(2)13-26(31(25)35-27(23)14-17)29-24-11-9-21-16-22(32(5,6)7)15-19(3)28(21)30(24)34-20(4)33-29/h8-16H,1-7H3 |
| InChIKey | ZMOIDJLCZIEASQ-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|