C43H49IrN2O3- — CID 176722766
8-tert-butyl-2,10-dimethyl-4-(7-methyl-3H-dibenzofuran-3-id-4-yl)benzo[h]quinazoline;(Z)-5-hydroxy-2,2,6,6-tetramethyloct-4-en-3-one;iridium (PubChem CID 176722766) has the molecular formula C43H49IrN2O3- and a molecular weight of 834.09 g/mol. Its IUPAC name is 8-tert-butyl-2,10-dimethyl-4-(7-methyl-3H-dibenzofuran-3-id-4-yl)benzo[h]quinazoline;(Z)-5-hydroxy-2,2,6,6-tetramethyloct-4-en-3-one;iridium.
| Compound Name | 8-tert-butyl-2,10-dimethyl-4-(7-methyl-3H-dibenzofuran-3-id-4-yl)benzo[h]quinazoline;(Z)-5-hydroxy-2,2,6,6-tetramethyloct-4-en-3-one;iridium |
|---|---|
| PubChem CID | 176722766 |
| Molecular Formula | C43H49IrN2O3- |
| Molecular Weight | 834.09 g/mol |
| Exact Mass | 834.34 |
| IUPAC Name | 8-tert-butyl-2,10-dimethyl-4-(7-methyl-3H-dibenzofuran-3-id-4-yl)benzo[h]quinazoline;(Z)-5-hydroxy-2,2,6,6-tetramethyloct-4-en-3-one;iridium |
| SMILES | CCC(C)(C)/C(O)=C/C(=O)C(C)(C)C.Cc1ccc2c(c1)oc1c(-c3nc(C)nc4c3ccc3cc(C(C)(C)C)cc(C)c34)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C31H27N2O.C12H22O2.Ir/c1-17-10-12-22-23-8-7-9-25(30(23)34-26(22)14-17)28-24-13-11-20-16-21(31(4,5)6)15-18(2)27(20)29(24)33-19(3)32-28;1-7-12(5,6)10(14)8-9(13)11(2,3)4;/h7-8,10-16H,1-6H3;8,14H,7H2,1-6H3;/q-1;;/b;10-8-; |
| InChIKey | KGZQWAVPVXUYBF-VINONVIGSA-N |
| XLogP | 11.85 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.09 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|