C40H44IrN3O3- — CID 162692388
4-(3H-dibenzofuran-3-id-4-yl)-2,7,10-trimethylpyrido[3,4-h]quinazoline;(Z)-3-ethyl-6-hydroxy-3,7,7-trimethylnon-5-en-4-one;iridium (PubChem CID 162692388) has the molecular formula C40H44IrN3O3- and a molecular weight of 807.03 g/mol. Its IUPAC name is 4-(3H-dibenzofuran-3-id-4-yl)-2,7,10-trimethylpyrido[3,4-h]quinazoline;(Z)-3-ethyl-6-hydroxy-3,7,7-trimethylnon-5-en-4-one;iridium.
| Compound Name | 4-(3H-dibenzofuran-3-id-4-yl)-2,7,10-trimethylpyrido[3,4-h]quinazoline;(Z)-3-ethyl-6-hydroxy-3,7,7-trimethylnon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 162692388 |
| Molecular Formula | C40H44IrN3O3- |
| Molecular Weight | 807.03 g/mol |
| Exact Mass | 807.30 |
| IUPAC Name | 4-(3H-dibenzofuran-3-id-4-yl)-2,7,10-trimethylpyrido[3,4-h]quinazoline;(Z)-3-ethyl-6-hydroxy-3,7,7-trimethylnon-5-en-4-one;iridium |
| SMILES | CCC(C)(CC)C(=O)/C=C(\O)C(C)(C)CC.Cc1nc(-c2[c-]ccc3c2oc2ccccc23)c2ccc3c(C)ncc(C)c3c2n1.[Ir] |
| InChI | InChI=1S/C26H18N3O.C14H26O2.Ir/c1-14-13-27-15(2)17-11-12-20-24(28-16(3)29-25(20)23(14)17)21-9-6-8-19-18-7-4-5-10-22(18)30-26(19)21;1-7-13(4,5)11(15)10-12(16)14(6,8-2)9-3;/h4-8,10-13H,1-3H3;10,15H,7-9H2,1-6H3;/q-1;;/b;11-10-; |
| InChIKey | TZXVYIAUKWWLES-HADILQTOSA-N |
| XLogP | 10.73 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.03 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|