C43H51IrN2O2- — CID 162692400
8-tert-butyl-2,10-dimethyl-4-(3-phenylbenzene-6-id-1-yl)benzo[h]quinazoline;(Z)-6-ethyl-5-hydroxy-2,2,6-trimethyloct-4-en-3-one;iridium (PubChem CID 162692400) has the molecular formula C43H51IrN2O2- and a molecular weight of 820.11 g/mol. Its IUPAC name is 8-tert-butyl-2,10-dimethyl-4-(3-phenylbenzene-6-id-1-yl)benzo[h]quinazoline;(Z)-6-ethyl-5-hydroxy-2,2,6-trimethyloct-4-en-3-one;iridium.
| Compound Name | 8-tert-butyl-2,10-dimethyl-4-(3-phenylbenzene-6-id-1-yl)benzo[h]quinazoline;(Z)-6-ethyl-5-hydroxy-2,2,6-trimethyloct-4-en-3-one;iridium |
|---|---|
| PubChem CID | 162692400 |
| Molecular Formula | C43H51IrN2O2- |
| Molecular Weight | 820.11 g/mol |
| Exact Mass | 820.36 |
| IUPAC Name | 8-tert-butyl-2,10-dimethyl-4-(3-phenylbenzene-6-id-1-yl)benzo[h]quinazoline;(Z)-6-ethyl-5-hydroxy-2,2,6-trimethyloct-4-en-3-one;iridium |
| SMILES | CCC(C)(CC)/C(O)=C/C(=O)C(C)(C)C.Cc1nc(-c2[c-]ccc(-c3ccccc3)c2)c2ccc3cc(C(C)(C)C)cc(C)c3c2n1.[Ir] |
| InChI | InChI=1S/C30H27N2.C13H24O2.Ir/c1-19-16-25(30(3,4)5)18-23-14-15-26-28(31-20(2)32-29(26)27(19)23)24-13-9-12-22(17-24)21-10-7-6-8-11-21;1-7-13(6,8-2)11(15)9-10(14)12(3,4)5;/h6-12,14-18H,1-5H3;9,15H,7-8H2,1-6H3;/q-1;;/b;11-9-; |
| InChIKey | AYOLYGYXCXIWEQ-UTAAMMLDSA-N |
| XLogP | 11.70 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.11 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|