C35H36N2O — CID 162692524
4-dibenzofuran-4-yl-8,10-bis(2-methylpropyl)-2-propan-2-ylbenzo[h]quinazoline (PubChem CID 162692524) has the molecular formula C35H36N2O and a molecular weight of 500.69 g/mol. Its IUPAC name is 4-dibenzofuran-4-yl-8,10-bis(2-methylpropyl)-2-propan-2-ylbenzo[h]quinazoline.
| Compound Name | 4-dibenzofuran-4-yl-8,10-bis(2-methylpropyl)-2-propan-2-ylbenzo[h]quinazoline |
|---|---|
| PubChem CID | 162692524 |
| Molecular Formula | C35H36N2O |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | 4-dibenzofuran-4-yl-8,10-bis(2-methylpropyl)-2-propan-2-ylbenzo[h]quinazoline |
| SMILES | CC(C)Cc1cc(CC(C)C)c2c(ccc3c(-c4cccc5c4oc4ccccc45)nc(C(C)C)nc32)c1 |
| InChI | InChI=1S/C35H36N2O/c1-20(2)16-23-18-24-14-15-28-32(29-12-9-11-27-26-10-7-8-13-30(26)38-34(27)29)36-35(22(5)6)37-33(28)31(24)25(19-23)17-21(3)4/h7-15,18-22H,16-17H2,1-6H3 |
| InChIKey | VFFLHUOSCUOIPI-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|