C37H33N3O — CID 162692534
8-[10-methyl-8-(2-methylpropyl)-2-propan-2-ylbenzo[h]quinazolin-4-yl]-2-phenyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 162692534) has the molecular formula C37H33N3O and a molecular weight of 535.69 g/mol. Its IUPAC name is 8-[10-methyl-8-(2-methylpropyl)-2-propan-2-ylbenzo[h]quinazolin-4-yl]-2-phenyl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 8-[10-methyl-8-(2-methylpropyl)-2-propan-2-ylbenzo[h]quinazolin-4-yl]-2-phenyl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 162692534 |
| Molecular Formula | C37H33N3O |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | 8-[10-methyl-8-(2-methylpropyl)-2-propan-2-ylbenzo[h]quinazolin-4-yl]-2-phenyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1cc(CC(C)C)cc2ccc3c(-c4cccc5c4oc4nc(-c6ccccc6)ccc45)nc(C(C)C)nc3c12 |
| InChI | InChI=1S/C37H33N3O/c1-21(2)18-24-19-23(5)32-26(20-24)14-15-29-33(39-36(22(3)4)40-34(29)32)30-13-9-12-27-28-16-17-31(25-10-7-6-8-11-25)38-37(28)41-35(27)30/h6-17,19-22H,18H2,1-5H3 |
| InChIKey | HRIUQQSAPTUATJ-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|