C28H23N3O — CID 176722744
2-methyl-8-(2-methyl-10-propan-2-ylbenzo[h]quinazolin-4-yl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 176722744) has the molecular formula C28H23N3O and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-methyl-8-(2-methyl-10-propan-2-ylbenzo[h]quinazolin-4-yl)-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2-methyl-8-(2-methyl-10-propan-2-ylbenzo[h]quinazolin-4-yl)-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 176722744 |
| Molecular Formula | C28H23N3O |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 2-methyl-8-(2-methyl-10-propan-2-ylbenzo[h]quinazolin-4-yl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(n1)oc1c(-c3nc(C)nc4c3ccc3cccc(C(C)C)c34)cccc12 |
| InChI | InChI=1S/C28H23N3O/c1-15(2)19-8-5-7-18-12-14-22-25(30-17(4)31-26(22)24(18)19)23-10-6-9-20-21-13-11-16(3)29-28(21)32-27(20)23/h5-15H,1-4H3 |
| InChIKey | ACTKNZLMGODBBM-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|