C29H26N2OSi — CID 162692418
(4-dibenzofuran-4-yl-8,10-dimethylbenzo[h]quinazolin-9-yl)-trimethylsilane (PubChem CID 162692418) has the molecular formula C29H26N2OSi and a molecular weight of 446.63 g/mol. Its IUPAC name is (4-dibenzofuran-4-yl-8,10-dimethylbenzo[h]quinazolin-9-yl)-trimethylsilane.
| Compound Name | (4-dibenzofuran-4-yl-8,10-dimethylbenzo[h]quinazolin-9-yl)-trimethylsilane |
|---|---|
| PubChem CID | 162692418 |
| Molecular Formula | C29H26N2OSi |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (4-dibenzofuran-4-yl-8,10-dimethylbenzo[h]quinazolin-9-yl)-trimethylsilane |
| SMILES | Cc1cc2ccc3c(-c4cccc5c4oc4ccccc45)ncnc3c2c(C)c1[Si](C)(C)C |
| InChI | InChI=1S/C29H26N2OSi/c1-17-15-19-13-14-22-26(30-16-31-27(22)25(19)18(2)29(17)33(3,4)5)23-11-8-10-21-20-9-6-7-12-24(20)32-28(21)23/h6-16H,1-5H3 |
| InChIKey | XOWWRIDKQABCDP-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|