C27H23GeN3O — CID 176722779
[4-([1]benzofuro[2,3-b]pyridin-8-yl)-10-methylbenzo[h]quinazolin-8-yl]-trimethylgermane (PubChem CID 176722779) has the molecular formula C27H23GeN3O and a molecular weight of 478.11 g/mol. Its IUPAC name is [4-([1]benzofuro[2,3-b]pyridin-8-yl)-10-methylbenzo[h]quinazolin-8-yl]-trimethylgermane.
| Compound Name | [4-([1]benzofuro[2,3-b]pyridin-8-yl)-10-methylbenzo[h]quinazolin-8-yl]-trimethylgermane |
|---|---|
| PubChem CID | 176722779 |
| Molecular Formula | C27H23GeN3O |
| Molecular Weight | 478.11 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | [4-([1]benzofuro[2,3-b]pyridin-8-yl)-10-methylbenzo[h]quinazolin-8-yl]-trimethylgermane |
| SMILES | Cc1cc([Ge](C)(C)C)cc2ccc3c(-c4cccc5c4oc4ncccc45)ncnc3c12 |
| InChI | InChI=1S/C27H23GeN3O/c1-16-13-18(28(2,3)4)14-17-10-11-21-24(30-15-31-25(21)23(16)17)22-8-5-7-19-20-9-6-12-29-27(20)32-26(19)22/h5-15H,1-4H3 |
| InChIKey | LWLRGXJPSQTDFI-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.11 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|