C30H29GeN3O — CID 162692980
[4-(2,5-dimethyl-[1]benzofuro[2,3-b]pyridin-8-yl)-8,10-dimethylbenzo[h]quinazolin-9-yl]-trimethylgermane (PubChem CID 162692980) has the molecular formula C30H29GeN3O and a molecular weight of 520.19 g/mol. Its IUPAC name is [4-(2,5-dimethyl-[1]benzofuro[2,3-b]pyridin-8-yl)-8,10-dimethylbenzo[h]quinazolin-9-yl]-trimethylgermane.
| Compound Name | [4-(2,5-dimethyl-[1]benzofuro[2,3-b]pyridin-8-yl)-8,10-dimethylbenzo[h]quinazolin-9-yl]-trimethylgermane |
|---|---|
| PubChem CID | 162692980 |
| Molecular Formula | C30H29GeN3O |
| Molecular Weight | 520.19 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | [4-(2,5-dimethyl-[1]benzofuro[2,3-b]pyridin-8-yl)-8,10-dimethylbenzo[h]quinazolin-9-yl]-trimethylgermane |
| SMILES | Cc1ccc2c(n1)oc1c(-c3ncnc4c3ccc3cc(C)c([Ge](C)(C)C)c(C)c34)ccc(C)c12 |
| InChI | InChI=1S/C30H29GeN3O/c1-16-8-11-23(29-24(16)21-12-9-18(3)34-30(21)35-29)27-22-13-10-20-14-17(2)26(31(5,6)7)19(4)25(20)28(22)33-15-32-27/h8-15H,1-7H3 |
| InChIKey | MQDXNGQCBXVQCF-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.19 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|