C29H27N3OSi — CID 176722750
[8,10-dimethyl-4-(5-methyl-[1]benzofuro[2,3-b]pyridin-8-yl)benzo[h]quinazolin-9-yl]-trimethylsilane (PubChem CID 176722750) has the molecular formula C29H27N3OSi and a molecular weight of 461.64 g/mol. Its IUPAC name is [8,10-dimethyl-4-(5-methyl-[1]benzofuro[2,3-b]pyridin-8-yl)benzo[h]quinazolin-9-yl]-trimethylsilane.
| Compound Name | [8,10-dimethyl-4-(5-methyl-[1]benzofuro[2,3-b]pyridin-8-yl)benzo[h]quinazolin-9-yl]-trimethylsilane |
|---|---|
| PubChem CID | 176722750 |
| Molecular Formula | C29H27N3OSi |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | [8,10-dimethyl-4-(5-methyl-[1]benzofuro[2,3-b]pyridin-8-yl)benzo[h]quinazolin-9-yl]-trimethylsilane |
| SMILES | Cc1cc2ccc3c(-c4ccc(C)c5c4oc4ncccc45)ncnc3c2c(C)c1[Si](C)(C)C |
| InChI | InChI=1S/C29H27N3OSi/c1-16-9-11-22(27-23(16)20-8-7-13-30-29(20)33-27)25-21-12-10-19-14-17(2)28(34(4,5)6)18(3)24(19)26(21)32-15-31-25/h7-15H,1-6H3 |
| InChIKey | KEQLGULNMRAUIY-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|