C20H15ClN2 — CID 150583315
10-chloro-4-(3,5-dimethylphenyl)benzo[h]quinazoline (PubChem CID 150583315) has the molecular formula C20H15ClN2 and a molecular weight of 318.81 g/mol. Its IUPAC name is 10-chloro-4-(3,5-dimethylphenyl)benzo[h]quinazoline.
| Compound Name | 10-chloro-4-(3,5-dimethylphenyl)benzo[h]quinazoline |
|---|---|
| PubChem CID | 150583315 |
| Molecular Formula | C20H15ClN2 |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 10-chloro-4-(3,5-dimethylphenyl)benzo[h]quinazoline |
| SMILES | Cc1cc(C)cc(-c2ncnc3c2ccc2cccc(Cl)c23)c1 |
| InChI | InChI=1S/C20H15ClN2/c1-12-8-13(2)10-15(9-12)19-16-7-6-14-4-3-5-17(21)18(14)20(16)23-11-22-19/h3-11H,1-2H3 |
| InChIKey | IOHPQMZPTWWSEG-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|