C27H24N2 — CID 162692728
5-(2-deuteriopropan-2-yl)-1-(3,5-dimethylphenyl)naphtho[1,2-h]quinazoline (PubChem CID 162692728) has the molecular formula C27H24N2 and a molecular weight of 377.51 g/mol. Its IUPAC name is 5-(2-deuteriopropan-2-yl)-1-(3,5-dimethylphenyl)naphtho[1,2-h]quinazoline.
| Compound Name | 5-(2-deuteriopropan-2-yl)-1-(3,5-dimethylphenyl)naphtho[1,2-h]quinazoline |
|---|---|
| PubChem CID | 162692728 |
| Molecular Formula | C27H24N2 |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 5-(2-deuteriopropan-2-yl)-1-(3,5-dimethylphenyl)naphtho[1,2-h]quinazoline |
| SMILES | [2H]C(C)(C)c1cc2ccccc2c2ccc3c(-c4cc(C)cc(C)c4)ncnc3c12 |
| InChI | InChI=1S/C27H24N2/c1-16(2)24-14-19-7-5-6-8-21(19)22-9-10-23-26(28-15-29-27(23)25(22)24)20-12-17(3)11-18(4)13-20/h5-16H,1-4H3/i16D |
| InChIKey | BFKKZFRKNPLPCS-QNLPYAOMSA-N |
| XLogP | 7.34 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|