C28H22F6N2S — CID 164733688
7-(3,5-dimethylphenyl)-2-(3,3,3-trifluoro-2,2-dimethylpropyl)-11-(trifluoromethyl)-[1]benzothiolo[5,4-g]quinazoline (PubChem CID 164733688) has the molecular formula C28H22F6N2S and a molecular weight of 532.55 g/mol. Its IUPAC name is 7-(3,5-dimethylphenyl)-2-(3,3,3-trifluoro-2,2-dimethylpropyl)-11-(trifluoromethyl)-[1]benzothiolo[5,4-g]quinazoline.
| Compound Name | 7-(3,5-dimethylphenyl)-2-(3,3,3-trifluoro-2,2-dimethylpropyl)-11-(trifluoromethyl)-[1]benzothiolo[5,4-g]quinazoline |
|---|---|
| PubChem CID | 164733688 |
| Molecular Formula | C28H22F6N2S |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | 7-(3,5-dimethylphenyl)-2-(3,3,3-trifluoro-2,2-dimethylpropyl)-11-(trifluoromethyl)-[1]benzothiolo[5,4-g]quinazoline |
| SMILES | Cc1cc(C)cc(-c2ncnc3c(C(F)(F)F)c4c(ccc5sc(CC(C)(C)C(F)(F)F)cc54)cc23)c1 |
| InChI | InChI=1S/C28H22F6N2S/c1-14-7-15(2)9-17(8-14)24-20-10-16-5-6-21-19(11-18(37-21)12-26(3,4)28(32,33)34)22(16)23(27(29,30)31)25(20)36-13-35-24/h5-11,13H,12H2,1-4H3 |
| InChIKey | NLPKXNXXHHDSGE-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|