C24H29F3N2S — CID 160746379
4-(3,5-dimethylphenyl)-6-(2,2-dimethylpropyl)-7-(3,3,3-trifluoro-2,2-dimethylpropyl)thieno[3,2-d]pyrimidine (PubChem CID 160746379) has the molecular formula C24H29F3N2S and a molecular weight of 434.57 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-6-(2,2-dimethylpropyl)-7-(3,3,3-trifluoro-2,2-dimethylpropyl)thieno[3,2-d]pyrimidine.
| Compound Name | 4-(3,5-dimethylphenyl)-6-(2,2-dimethylpropyl)-7-(3,3,3-trifluoro-2,2-dimethylpropyl)thieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 160746379 |
| Molecular Formula | C24H29F3N2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-6-(2,2-dimethylpropyl)-7-(3,3,3-trifluoro-2,2-dimethylpropyl)thieno[3,2-d]pyrimidine |
| SMILES | Cc1cc(C)cc(-c2ncnc3c(CC(C)(C)C(F)(F)F)c(CC(C)(C)C)sc23)c1 |
| InChI | InChI=1S/C24H29F3N2S/c1-14-8-15(2)10-16(9-14)19-21-20(29-13-28-19)17(11-23(6,7)24(25,26)27)18(30-21)12-22(3,4)5/h8-10,13H,11-12H2,1-7H3 |
| InChIKey | DOCUINZCQZLWMB-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |