C16H10S2 — CID 134966612
5-naphthalen-2-ylthieno[3,2-b]thiophene (PubChem CID 134966612) has the molecular formula C16H10S2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 5-naphthalen-2-ylthieno[3,2-b]thiophene.
| Compound Name | 5-naphthalen-2-ylthieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 134966612 |
| Molecular Formula | C16H10S2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 5-naphthalen-2-ylthieno[3,2-b]thiophene |
| SMILES | c1ccc2cc(-c3cc4sccc4s3)ccc2c1 |
| InChI | InChI=1S/C16H10S2/c1-2-4-12-9-13(6-5-11(12)3-1)15-10-16-14(18-15)7-8-17-16/h1-10H |
| InChIKey | DLNQUOWICDFMSH-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |