C18H12O2S2 — CID 102590208
2-(4-methoxyphenyl)thieno[3,2-e][1]benzothiole-7-carbaldehyde (PubChem CID 102590208) has the molecular formula C18H12O2S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)thieno[3,2-e][1]benzothiole-7-carbaldehyde.
| Compound Name | 2-(4-methoxyphenyl)thieno[3,2-e][1]benzothiole-7-carbaldehyde |
|---|---|
| PubChem CID | 102590208 |
| Molecular Formula | C18H12O2S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 2-(4-methoxyphenyl)thieno[3,2-e][1]benzothiole-7-carbaldehyde |
| SMILES | COc1ccc(-c2cc3c(ccc4sc(C=O)cc43)s2)cc1 |
| InChI | InChI=1S/C18H12O2S2/c1-20-12-4-2-11(3-5-12)18-9-15-14-8-13(10-19)21-16(14)6-7-17(15)22-18/h2-10H,1H3 |
| InChIKey | VETZINAHOJAKJB-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|